CAS 879-13-0

2(1H)-Quinolinone, 3-amino-3,4-dihydro-1-methyl-, hydrochloride (1:1)

Description:

2(1H)-Quinolinone, 3-amino-3,4-dihydro-1-methyl-, hydrochloride (1:1), with the CAS number 879-13-0, is a chemical compound characterized by its quinolinone structure, which features a bicyclic aromatic system. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The molecular structure includes an amino group and a methyl group, contributing to its basicity and potential biological activity. It is often studied for its pharmacological properties, including potential applications in medicinal chemistry, particularly in the development of therapeutic agents. The compound may exhibit various biological activities, including antimicrobial and anti-inflammatory effects, making it of interest in pharmaceutical research. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₂N₂O·ClH

InChI: InChI=1S/C10H12N2O.ClH/c1-12-9-5-3-2-4-7(9)6-8(11)10(12)13;/h2-5,8H,6,11H2,1H3;1H

InChI key: InChIKey=IXPKJDGJYDFJDU-UHFFFAOYSA-N

SMILES: CN1C=2C(CC(N)C1=O)=CC=CC2.Cl

Synonyms:

• 3-Amino-1-methyl-1,2,3,4-tetrahydroquinolin-2-one hydrochloride
• Carbostyril, 3-amino-3,4-dihydro-1-methyl-, hydrochloride
• 2(1H)-Quinolinone, 3-amino-3,4-dihydro-1-methyl-, hydrochloride (1:1)

3-Amino-1-methyl-1,2,3,4-tetrahydroquinolin-2-one hydrochloride

CAS: 879-13-0

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 212.67 g/mol

Ref: 3D-AAA87913