CymitQuimica logo

CAS 879-41-4

:

1-(pyrimidin-2-yl)-1H-1,2,4-triazole-3,5-diamine

Description:
1-(Pyrimidin-2-yl)-1H-1,2,4-triazole-3,5-diamine, with the CAS number 879-41-4, is a chemical compound characterized by its triazole and pyrimidine functional groups. This substance typically appears as a solid and is known for its potential applications in pharmaceuticals, particularly as an antifungal agent or in the development of agrochemicals. The presence of the triazole ring contributes to its biological activity, while the amino groups enhance its reactivity and solubility in various solvents. The compound's structure allows for hydrogen bonding, which can influence its interactions with biological targets. Additionally, it may exhibit properties such as moderate stability under standard conditions, but its reactivity can vary depending on the surrounding environment. As with many nitrogen-containing heterocycles, it may also display interesting electronic properties, making it a subject of interest in medicinal chemistry and material science. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C6H7N7
InChI:InChI=1/C6H7N7/c7-4-11-5(8)13(12-4)6-9-2-1-3-10-6/h1-3H,(H4,7,8,11,12)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.