CAS 879-98-1
:3-Hydroxy-4-methoxybenzenesulfonic acid
Description:
3-Hydroxy-4-methoxybenzenesulfonic acid, with the CAS number 879-98-1, is an aromatic sulfonic acid characterized by the presence of a hydroxyl group and a methoxy group on a benzene ring, along with a sulfonic acid functional group. This compound typically appears as a white to light yellow solid and is soluble in water due to the polar nature of the sulfonic acid group. It exhibits acidic properties, which can influence its reactivity and interactions in various chemical environments. The presence of the hydroxyl and methoxy groups can also contribute to its potential as a ligand in coordination chemistry or as a reagent in organic synthesis. Additionally, this compound may have applications in dye manufacturing, pharmaceuticals, or as an intermediate in the synthesis of other chemical compounds. Its stability and reactivity can vary depending on the conditions, such as pH and temperature, making it important to consider these factors in practical applications.
Formula:C7H8O5S
InChI:InChI=1S/C7H8O5S/c1-12-7-3-2-5(4-6(7)8)13(9,10)11/h2-4,8H,1H3,(H,9,10,11)
InChI key:InChIKey=PFXZMBNHLUZPPW-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC(O)=C(OC)C=C1
Synonyms:- 3-Hydroxy-4-methoxybenzenesulfonic acid
- Benzenesulfonic acid, 3-hydroxy-4-methoxy-
- 5-Guaiacolsulfonic acid
- 3-Hydroxy-4-methoxybenzene-1-sulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3-Hydroxy-4-methoxybenzenesulfonic Acid
CAS:Controlled ProductFormula:C7H8O5SColor and Shape:NeatMolecular weight:401.669
