CAS 87901-84-6
:5-Chrysenecarboxylic acid, 8-methoxy-, methyl ester
Description:
5-Chrysenecarboxylic acid, 8-methoxy-, methyl ester, with the CAS number 87901-84-6, is an organic compound characterized by its complex polycyclic aromatic structure. This substance features a chrysenecarboxylic acid backbone, which is a derivative of chrysene, a polycyclic aromatic hydrocarbon. The presence of a methoxy group at the 8-position and a methyl ester functional group contributes to its chemical reactivity and solubility properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structure, which can influence their behavior in biological systems and environmental contexts. The methyl ester form suggests that it may be involved in esterification reactions, potentially serving as a precursor for further chemical modifications. Additionally, such compounds may exhibit interesting photophysical properties, making them relevant in fields like organic electronics or materials science. However, specific applications and biological activities would depend on further empirical studies and context-specific evaluations.
Formula:C21H16O3
InChI:InChI=1S/C21H16O3/c1-23-15-8-10-16-14(11-15)12-19(21(22)24-2)20-17-6-4-3-5-13(17)7-9-18(16)20/h3-12H,1-2H3
InChI key:LAFXNCZTULDEDI-UHFFFAOYSA-N
SMILES:COC1=CC2=CC(=C3C(=C2C=C1)C=CC4=CC=CC=C43)C(=O)OC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
