CAS 879034-73-8

2-amino-5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7(1H)-one

Description:

2-amino-5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7(1H)-one is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features an amino group at the 2-position and two methyl groups at the 5 and 6 positions of the triazole ring, contributing to its chemical reactivity and potential biological activity. The presence of the carbonyl group at the 7-position enhances its ability to participate in hydrogen bonding, which can influence its solubility and interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anti-cancer activities. Its molecular structure allows for various modifications, which can be explored to optimize its efficacy and selectivity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of interest for further research in drug development and synthesis.

Formula: C₇H₉N₅O

InChI: InChI=1/C7H9N5O/c1-3-4(2)9-7-10-6(8)11-12(7)5(3)13/h1-2H3,(H3,8,9,10,11)

SMILES: Cc1c(C)nc2[nH]c(=N)[nH]n2c1=O

Synonyms:

• [1,2,4]triazolo[1,5-a]pyrimidin-7(4H)-one, 2-amino-5,6-dimethyl-

2-amino-5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7(4H)-one

CAS: 879034-73-8

Formula: C₇H₉N₅O

Molecular weight: 179.1793

Ref: IN-DA004E04

2-amino-5,6-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-7(4H)-one

CAS: 879034-73-8

Formula: C₇H₉N₅O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 179.183

Ref: 10-F315882