CAS 87904-86-7

2H-1,4-Thiazin-3(4H)-one, 4-(1-methylethyl)-2-(methylthio)-

Description:

2H-1,4-Thiazin-3(4H)-one, 4-(1-methylethyl)-2-(methylthio)-, with the CAS number 87904-86-7, is a heterocyclic compound characterized by a thiazine ring structure. This compound features a sulfur atom within the ring, contributing to its unique chemical properties. The presence of a methylthio group and an isopropyl group (1-methylethyl) enhances its reactivity and may influence its biological activity. Thiazine derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability and solubility characteristics can vary based on the substituents present, which can affect its behavior in different environments. Overall, this compound exemplifies the diverse chemistry associated with thiazine derivatives, highlighting their significance in various chemical and biological contexts.

Formula: C₈H₁₃NOS₂

InChI: InChI=1S/C8H13NOS2/c1-6(2)9-4-5-12-8(11-3)7(9)10/h4-6,8H,1-3H3

InChI key: ZLXLBCVSNULVNB-UHFFFAOYSA-N

SMILES: CC(C)N1C=CSC(C1=O)SC

2H-1,4-Thiazin-3(4H)-one, 4-(1-methylethyl)-2-(methylthio)-

CAS: 87904-86-7

Formula: C₈H₁₃NOS₂

Molecular weight: 203.3249

Ref: IN-DA004E02