CAS 879053-56-2
:4-(4-ethoxy-3-methylphenyl)-4-hydroxybutanoic acid
Description:
4-(4-ethoxy-3-methylphenyl)-4-hydroxybutanoic acid, identified by its CAS number 879053-56-2, is an organic compound characterized by its complex structure that includes a hydroxybutanoic acid moiety and an aromatic ring substituted with an ethoxy and a methyl group. This compound typically exhibits properties associated with both hydrophilicity and lipophilicity due to the presence of the hydroxy group and the ethoxy substituent, which can influence its solubility in various solvents. The aromatic ring contributes to its potential for engaging in π-π interactions, while the hydroxy group can participate in hydrogen bonding. Such characteristics may render this compound useful in various applications, including pharmaceuticals and agrochemicals, where its biological activity could be of interest. Additionally, the presence of multiple functional groups suggests that it may undergo various chemical reactions, making it a versatile compound in synthetic chemistry. Further studies would be necessary to elucidate its specific reactivity and potential applications in greater detail.
Formula:C13H18O4
InChI:InChI=1/C13H18O4/c1-3-17-12-6-4-10(8-9(12)2)11(14)5-7-13(15)16/h4,6,8,11,14H,3,5,7H2,1-2H3,(H,15,16)
SMILES:CCOc1ccc(cc1C)C(CCC(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
