CAS 879053-63-1

4-(5-ethyl-2-methoxyphenyl)-4-hydroxybutanoic acid

Description:

4-(5-ethyl-2-methoxyphenyl)-4-hydroxybutanoic acid, identified by its CAS number 879053-63-1, is an organic compound characterized by its unique molecular structure, which includes a hydroxybutanoic acid moiety and a substituted phenyl group. The presence of the ethyl and methoxy groups on the phenyl ring contributes to its hydrophobic characteristics, while the hydroxy and carboxylic acid functional groups enhance its polarity and potential for hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the context of drug development or as a potential therapeutic agent. Its solubility, stability, and reactivity can be influenced by the functional groups present, which may also affect its interaction with biological systems. As with many organic compounds, its properties can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its chemical behavior and potential applications.

Formula: C₁₃H₁₈O₄

InChI: InChI=1/C13H18O4/c1-3-9-4-6-12(17-2)10(8-9)11(14)5-7-13(15)16/h4,6,8,11,14H,3,5,7H2,1-2H3,(H,15,16)

SMILES: CCc1ccc(c(c1)C(CCC(=O)O)O)OC

4-(5-Ethyl-2-methoxyphenyl)-4-hydroxybutanoic acid

CAS: 879053-63-1

Formula: C₁₃H₁₈O₄

Molecular weight: 238.2796

Ref: IN-DA004DZW

4-(5-Ethyl-2-methoxy-phenyl)-4-hydroxy-butyric acid

CAS: 879053-63-1

Formula: C₁₃H₁₈O₄

Purity: 95.0%

Molecular weight: 238.283

Ref: 10-F060089