CAS 879093-02-4

4-chloro-2,5-difluorobenzaldehyde

Description:

4-Chloro-2,5-difluorobenzaldehyde is an aromatic aldehyde characterized by the presence of a benzene ring substituted with a chlorine atom and two fluorine atoms at the 2 and 5 positions, along with an aldehyde functional group (-CHO) at the 1 position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity due to the aldehyde group, which can participate in various chemical reactions, including nucleophilic addition and condensation reactions. The presence of electronegative fluorine and chlorine atoms influences its electronic properties, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its unique substitution pattern can impart specific physical properties, such as boiling and melting points, as well as solubility characteristics in organic solvents. Safety precautions should be taken when handling this compound, as it may pose health hazards if inhaled or ingested.

Formula: C₇H₃ClF₂O

InChI: InChI=1/C7H3ClF2O/c8-5-2-6(9)4(3-11)1-7(5)10/h1-3H

SMILES: c1c(C=O)c(cc(c1F)Cl)F

Synonyms:

• Benzaldehyde, 4-chloro-2,5-difluoro-

4-Chloro-2,5-difluorobenzaldehyde

CAS: 879093-02-4

Formula: C₇H₃ClF₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.5479

Ref: IN-DA004HKS

4-Chloro-2,5-difluorobenzaldehyde

CAS: 879093-02-4

4-Chloro-2,5-difluorobenzaldehyde

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.55g/mol

Ref: 54-PC53483

4-Chloro-2,5-difluorobenzaldehyde

CAS: 879093-02-4

Formula: C₇H₃ClF₂O

Purity: 97%

Color and Shape: Low Melting Solid

Molecular weight: 176.55

Ref: 10-F037585