CymitQuimica logo

CAS 87910-71-2

:

3-(2-methoxy-2-oxoethyl)-1,3-benzothiazol-3-ium bromide

Description:
3-(2-methoxy-2-oxoethyl)-1,3-benzothiazol-3-ium bromide is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a methoxy-oxoethyl group. This compound typically exhibits properties associated with quaternary ammonium salts, such as solubility in polar solvents and potential antimicrobial activity. The presence of the bromide ion suggests it may have ionic characteristics, contributing to its solubility in water and other polar solvents. The benzothiazole ring is known for its biological activity, often being involved in various pharmacological applications. Additionally, the methoxy and keto functional groups may influence its reactivity and interaction with biological systems. Overall, this compound's characteristics make it of interest in medicinal chemistry and material science, although specific applications would depend on further research into its biological and chemical behavior.
Formula:C10H10BrNO2S
InChI:InChI=1/C10H10NO2S.BrH/c1-13-10(12)6-11-7-14-9-5-3-2-4-8(9)11;/h2-5,7H,6H2,1H3;1H/q+1;/p-1
Synonyms:
  • Benzothiazolium, 3-(2-methoxy-2-oxoethyl)-, bromide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.