CAS 879123-84-9

N-(phenoxyacetyl)alanine

Description:

N-(phenoxyacetyl)alanine is an amino acid derivative characterized by the presence of a phenoxyacetyl group attached to the amino acid alanine. This compound typically exhibits properties associated with both amino acids and aromatic compounds, including solubility in polar solvents and potential interactions with biological systems due to its amino and carboxyl functional groups. The phenoxyacetyl moiety can enhance lipophilicity, potentially influencing its pharmacokinetic properties. As a derivative of alanine, it retains the basic structure of amino acids, which includes an amino group, a carboxyl group, and a side chain that contributes to its unique characteristics. This compound may be of interest in medicinal chemistry and biochemistry for its potential applications in drug design or as a biochemical probe. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, making it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₁H₁₃NO₄

InChI: InChI=1/C11H13NO4/c1-8(11(14)15)12-10(13)7-16-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,13)(H,14,15)

SMILES: CC(C(=O)O)N=C(COc1ccccc1)O

Synonyms:

• alanine, N-(2-phenoxyacetyl)-

2-(2-Phenoxyacetamido)propanoic acid

CAS: 879123-84-9

Versatile small molecule scaffold

Formula: C₁₁H₁₃NO₄

Purity: Min. 95%

Molecular weight: 223.22 g/mol

Ref: 3D-EKB12384