CymitQuimica logo

CAS 879127-67-0

:

2H-Pyran-3,5(4H,6H)-dione, ion(1-), sodium

Description:
2H-Pyran-3,5(4H,6H)-dione, ion(1-), sodium, also known as sodium 2H-pyran-3,5-dione, is a chemical compound characterized by its pyran ring structure, which features two carbonyl groups at the 3 and 5 positions. This compound typically exists as a sodium salt, indicating that it has a negative charge (anion) balanced by a sodium cation. The presence of the dione functional groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophiles. It is soluble in polar solvents, which enhances its utility in organic synthesis and biochemical applications. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, appropriate safety measures should be taken when handling it, including the use of personal protective equipment and adherence to safety data sheet guidelines.
Formula:C5H5O3·Na
InChI:InChI=1S/C5H5O3.Na/c6-4-1-5(7)3-8-2-4;/h1H,2-3H2;/q-1;+1
InChI key:HZHSOBOQRRNIDJ-UHFFFAOYSA-N
SMILES:C1C(=O)[CH-]C(=O)CO1.[Na+]
Found 2 products.