CAS 879132-49-7
:1,3-Dihydro-5-nitro-1′-[[2-(trimethylsilyl)ethoxy]methyl]spiro[2H-indene-2,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one
Description:
1,3-Dihydro-5-nitro-1′-[[2-(trimethylsilyl)ethoxy]methyl]spiro[2H-indene-2,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one, identified by its CAS number 879132-49-7, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both indene and pyrrolo-pyridine moieties. This compound features a nitro group, which can influence its reactivity and potential applications in medicinal chemistry. The presence of a trimethylsilyl group suggests enhanced stability and solubility, making it suitable for various synthetic applications. Additionally, the ethoxy group may contribute to its overall polarity and solubility in organic solvents. The intricate arrangement of functional groups within this molecule indicates potential biological activity, which could be explored in pharmacological studies. Overall, this compound exemplifies the diversity of organic chemistry and the potential for novel compounds in drug discovery and development.
Formula:C21H25N3O4Si
InChI:InChI=1S/C21H25N3O4Si/c1-29(2,3)10-9-28-14-23-19-18(5-4-8-22-19)21(20(23)25)12-15-6-7-17(24(26)27)11-16(15)13-21/h4-8,11H,9-10,12-14H2,1-3H3
InChI key:InChIKey=KDGIPVFZTWMOLH-UHFFFAOYSA-N
SMILES:O=C1C2(C=3C(N1COCC[Si](C)(C)C)=NC=CC3)CC=4C(C2)=CC=C(N(=O)=O)C4
Synonyms:- 1,3-Dihydro-5-nitro-1′-[[2-(trimethylsilyl)ethoxy]methyl]spiro[2H-indene-2,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one
- 5-Nitro-1′-[[2-(trimethylsilyl)ethoxy]methyl]-1,3-dihydrospiro(indene-2,3′-pyrrolo[2,3-b]pyridin)-2′(1′H)-one
- Spiro[2H-indene-2,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one, 1,3-dihydro-5-nitro-1′-[[2-(trimethylsilyl)ethoxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.