CAS 87919-17-3

1-(3-chloro-4-methylphenyl)-3-(2-hydroxyethyl)urea

Description:

1-(3-Chloro-4-methylphenyl)-3-(2-hydroxyethyl)urea, with the CAS number 87919-17-3, is an organic compound characterized by its urea functional group, which is linked to a substituted aromatic ring. The presence of a chloro group and a methyl group on the phenyl ring contributes to its unique chemical properties, influencing its reactivity and solubility. The hydroxyethyl substituent enhances its potential for hydrogen bonding, which can affect its interactions in biological systems and its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Additionally, the presence of halogen and hydroxyl groups can impart specific characteristics such as increased lipophilicity or altered metabolic pathways. Overall, the compound's characteristics are defined by its functional groups, which play a crucial role in determining its chemical behavior and potential applications.

Formula: C₁₀H₁₃ClN₂O₂

InChI: InChI=1/C10H13ClN2O2/c1-7-2-3-8(6-9(7)11)13-10(15)12-4-5-14/h2-3,6,14H,4-5H2,1H3,(H2,12,13,15)

InChI key: QMHYLFJGDLSVCG-UHFFFAOYSA-N

SMILES: CC1=C(C=C(C=C1)NC(=O)NCCO)Cl

1-(3-chloro-4-methylphenyl)-3-(2-hydroxyethyl)urea

CAS: 87919-17-3

Formula: C₁₀H₁₃ClN₂O₂

Molecular weight: 228.6754

Ref: IN-DA004FEW