CymitQuimica logo

CAS 87919-20-8

:

1-(2-hydroxyethyl)-3-(4-methoxyphenyl)-1-methylurea

Description:
1-(2-Hydroxyethyl)-3-(4-methoxyphenyl)-1-methylurea, with the CAS number 87919-20-8, is an organic compound characterized by its urea functional group, which is modified by a hydroxyethyl group and a methoxyphenyl substituent. This compound typically exhibits properties associated with urea derivatives, such as solubility in polar solvents due to the presence of the hydroxyethyl group, which can engage in hydrogen bonding. The methoxyphenyl group contributes to its hydrophobic character and may influence its biological activity and interaction with other molecules. The presence of both hydrophilic and hydrophobic components suggests potential applications in pharmaceuticals or agrochemicals, where such balance can enhance bioavailability or target specificity. Additionally, the compound may exhibit specific reactivity patterns typical of urea derivatives, including potential interactions with nucleophiles or electrophiles. Overall, its unique structure allows for diverse applications, particularly in medicinal chemistry, where modifications can lead to compounds with desired therapeutic effects.
Formula:C11H16N2O3
InChI:InChI=1/C11H16N2O3/c1-13(7-8-14)11(15)12-9-3-5-10(16-2)6-4-9/h3-6,14H,7-8H2,1-2H3,(H,12,15)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.