CymitQuimica logo

CAS 87919-23-1

:

1-(3-hydroxypropyl)-3-(4-methoxyphenyl)urea

Description:
1-(3-Hydroxypropyl)-3-(4-methoxyphenyl)urea, with the CAS number 87919-23-1, is an organic compound characterized by its urea functional group, which is central to its structure. This compound features a hydroxypropyl group and a methoxyphenyl group, contributing to its unique chemical properties. It is typically a white to off-white solid, and its solubility can vary depending on the solvent, often being more soluble in polar solvents due to the presence of the hydroxy group. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its molecular structure allows for potential interactions with biological targets, which can be explored in medicinal chemistry. Additionally, the presence of both hydrophilic and hydrophobic regions in its structure may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. As with many organic compounds, safety data should be consulted for handling and usage guidelines.
Formula:C11H16N2O3
InChI:InChI=1/C11H16N2O3/c1-16-10-5-3-9(4-6-10)13-11(15)12-7-2-8-14/h3-6,14H,2,7-8H2,1H3,(H2,12,13,15)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.