CAS 87919-30-0
:1-(4-chlorophenyl)-3-(1-hydroxybutan-2-yl)urea
Description:
1-(4-chlorophenyl)-3-(1-hydroxybutan-2-yl)urea, with the CAS number 87919-30-0, is a chemical compound that belongs to the class of ureas. This substance features a urea functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to two amine groups (NH2). The compound contains a 4-chlorophenyl group, indicating the presence of a chlorine atom substituted on a phenyl ring, which can influence its biological activity and solubility. Additionally, the presence of a 1-hydroxybutan-2-yl moiety suggests that it has a secondary alcohol functional group, contributing to its potential reactivity and interactions. This compound may exhibit various properties such as solubility in organic solvents, moderate stability under standard conditions, and potential applications in pharmaceuticals or agrochemicals, depending on its specific biological activity. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of chlorine, which can pose environmental and health risks.
Formula:C11H15ClN2O2
InChI:InChI=1/C11H15ClN2O2/c1-2-9(7-15)13-11(16)14-10-5-3-8(12)4-6-10/h3-6,9,15H,2,7H2,1H3,(H2,13,14,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
