CAS 87919-32-2
:1-(3-chloro-4-methylphenyl)-3-(1-hydroxybutan-2-yl)urea
Description:
1-(3-chloro-4-methylphenyl)-3-(1-hydroxybutan-2-yl)urea, with the CAS number 87919-32-2, is an organic compound characterized by its urea functional group, which is linked to a substituted aromatic ring and a hydroxybutan-2-yl moiety. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as moderate solubility in polar solvents due to the presence of the hydroxy group. The chloro and methyl substituents on the aromatic ring can influence its reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. As a urea derivative, it may also exhibit properties relevant to agricultural or pharmaceutical applications, including herbicidal or therapeutic effects. The presence of the hydroxybutan-2-yl group suggests potential for hydrogen bonding, which can affect its physical properties, such as melting point and boiling point. Overall, this compound's unique structure contributes to its specific chemical behavior and potential applications in various fields.
Formula:C12H17ClN2O2
InChI:InChI=1/C12H17ClN2O2/c1-3-9(7-16)14-12(17)15-10-5-4-8(2)11(13)6-10/h4-6,9,16H,3,7H2,1-2H3,(H2,14,15,17)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(3-chloro-4-methylphenyl)-3-(1-hydroxybutan-2-yl)urea
CAS:Formula:C12H17ClN2O2Molecular weight:256.7286
