CAS 87919-33-3
:1-(1-hydroxybutan-2-yl)-3-(4-methoxyphenyl)urea
Description:
1-(1-hydroxybutan-2-yl)-3-(4-methoxyphenyl)urea, with the CAS number 87919-33-3, is a chemical compound that belongs to the class of ureas. This substance features a urea functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to two amine groups (NH2). The compound has a hydroxybutyl side chain, contributing to its potential solubility and reactivity. The presence of a methoxyphenyl group indicates that it has aromatic characteristics, which can influence its electronic properties and interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest it could participate in hydrogen bonding due to the hydroxyl group, enhancing its solubility in polar solvents. Additionally, the methoxy group can affect the compound's lipophilicity and overall stability. Overall, this compound's unique structure may lead to diverse applications in medicinal chemistry and related fields.
Formula:C12H18N2O3
InChI:InChI=1/C12H18N2O3/c1-3-9(8-15)13-12(16)14-10-4-6-11(17-2)7-5-10/h4-7,9,15H,3,8H2,1-2H3,(H2,13,14,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
