CAS 87919-36-6

3-(3-chloro-4-methylphenyl)-1,1-bis(2-hydroxyethyl)urea

Description:

3-(3-chloro-4-methylphenyl)-1,1-bis(2-hydroxyethyl)urea, with the CAS number 87919-36-6, is a chemical compound that belongs to the class of ureas. It features a urea functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to two amine groups (NH2). This specific compound has a chlorinated aromatic ring, contributing to its potential biological activity and hydrophobic characteristics. The presence of two hydroxyethyl groups enhances its solubility in polar solvents, making it more amenable to interactions in biological systems. The chloromethyl substituent may influence its reactivity and interaction with various biological targets. This compound is of interest in pharmaceutical and agricultural research, particularly for its potential applications in drug development or as a herbicide. As with many chemical substances, safety and handling precautions are essential, as it may exhibit toxicity or environmental hazards. Proper characterization through methods such as NMR, IR spectroscopy, and mass spectrometry is crucial for understanding its properties and potential applications.

Formula: C₁₂H₁₇ClN₂O₃

InChI: InChI=1/C12H17ClN2O3/c1-9-2-3-10(8-11(9)13)14-12(18)15(4-6-16)5-7-17/h2-3,8,16-17H,4-7H2,1H3,(H,14,18)

3-(3-chloro-4-methylphenyl)-1,1-bis(2-hydroxyethyl)urea

CAS: 87919-36-6

Formula: C₁₂H₁₇ClN₂O₃

Molecular weight: 272.728

Ref: IN-DA004DQZ