CAS 87919-38-8
:3-(3-chloro-4-methylphenyl)-1-(2-hydroxyethyl)-1-methylurea
Description:
3-(3-chloro-4-methylphenyl)-1-(2-hydroxyethyl)-1-methylurea, with the CAS number 87919-38-8, is an organic compound characterized by its urea functional group, which is modified by a hydroxyethyl group and a chloro-substituted aromatic ring. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyethyl group, which can engage in hydrogen bonding. The chloro and methyl substituents on the aromatic ring influence its reactivity and stability, potentially affecting its biological activity. It may be used in various applications, including pharmaceuticals or agrochemicals, owing to its structural features that can interact with biological systems. The presence of the chloro group can also impart specific electronic properties, making it a candidate for further chemical modifications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H15ClN2O2
InChI:InChI=1/C11H15ClN2O2/c1-8-3-4-9(7-10(8)12)13-11(16)14(2)5-6-15/h3-4,7,15H,5-6H2,1-2H3,(H,13,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(3-chloro-4-methylphenyl)-1-(2-hydroxyethyl)-1-methylurea
CAS:Formula:C11H15ClN2O2Molecular weight:242.702
