CAS 879218-18-5

3-thienyl-[4-(trifluoromethyl)phenyl]methanone

Description:

3-Thienyl-[4-(trifluoromethyl)phenyl]methanone, identified by its CAS number 879218-18-5, is an organic compound characterized by the presence of a thienyl group and a trifluoromethyl-substituted phenyl moiety. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The trifluoromethyl group is known for its electron-withdrawing properties, which can significantly influence the compound's chemical behavior, including its acidity and reactivity towards nucleophiles. The thienyl ring, a five-membered aromatic heterocycle containing sulfur, adds to the compound's unique electronic properties and can enhance its biological activity. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and material science. Its synthesis and characterization would typically involve standard organic reactions, and its stability and solubility would depend on the specific conditions and solvents used.

Formula: C₁₂H₇F₃OS

InChI: InChI=1/C12H7F3OS/c13-12(14,15)10-3-1-8(2-4-10)11(16)9-5-6-17-7-9/h1-7H

SMILES: c1cc(ccc1C(=O)c1ccsc1)C(F)(F)F

3-(4-Trifluoromethylbenzoyl)thiophene

CAS: 879218-18-5

Formula: C₁₂H₇F₃OS

Purity: 97.0%

Molecular weight: 256.24

Ref: 10-F202345