CAS 87923-23-7

Bicyclo[4.2.0]octa-3,7-diene, 1,7-dimethyl-8-phenyl-, cis-

Description:

Bicyclo[4.2.0]octa-3,7-diene, 1,7-dimethyl-8-phenyl-, cis- (CAS 87923-23-7) is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of two fused cyclobutane rings. This compound features a diene system, indicating the presence of two double bonds within its structure, specifically located at the 3 and 7 positions. The presence of methyl groups at the 1 and 7 positions, along with a phenyl group at the 8 position, contributes to its overall stability and reactivity. The "cis" designation indicates that the substituents are oriented on the same side of the double bond, which can influence the compound's physical properties and reactivity. Bicyclic compounds like this one often exhibit interesting chemical behavior, including potential applications in organic synthesis and materials science. Its unique structure may also lead to specific interactions in biological systems, making it a subject of interest in medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of bicyclic organic molecules.

Formula: C₁₆H₁₈

InChI: InChI=1S/C16H18/c1-12-14-10-6-7-11-16(14,2)15(12)13-8-4-3-5-9-13/h3-9,14H,10-11H2,1-2H3/t14-,16-/m0/s1

InChI key: SAEMLFGYEUACQX-HOCLYGCPSA-N

SMILES: CC1=C([C@@]2([C@H]1CC=CC2)C)C3=CC=CC=C3