CymitQuimica logo

CAS 87925-27-7

:

2-(1-hydroxy-2-methylamino-ethyl)phenol benzoate

Description:
2-(1-Hydroxy-2-methylamino-ethyl)phenol benzoate, with the CAS number 87925-27-7, is a chemical compound that features a phenolic structure with a benzoate ester functional group. This compound typically exhibits characteristics associated with both phenols and amines, such as potential solubility in organic solvents and the ability to form hydrogen bonds due to the presence of hydroxyl and amino groups. The presence of the benzoate moiety may impart additional stability and influence its reactivity. It may also exhibit biological activity, which could be relevant in pharmaceutical applications. The compound's molecular structure suggests it could participate in various chemical reactions, including esterification and nucleophilic substitutions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 2-(1-hydroxy-2-methylamino-ethyl)phenol benzoate represents a complex organic molecule with diverse potential applications in research and industry.
Formula:C16H18NO4
InChI:InChI=1/C9H13NO2.C7H6O2/c1-10-6-9(12)7-4-2-3-5-8(7)11;8-7(9)6-4-2-1-3-5-6/h2-5,9-12H,6H2,1H3;1-5H,(H,8,9)/p-1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.