CymitQuimica logo

CAS 87929-13-3

:

5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole

Description:
5-[(6-Methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole, with the CAS number 87929-13-3, is a chemical compound characterized by its unique structure that includes a tetrazole ring and an indene derivative. The presence of the methoxy group contributes to its potential reactivity and solubility properties. Tetrazoles are known for their diverse biological activities and can serve as bioisosteres for carboxylic acids, often enhancing pharmacological properties. This compound may exhibit interesting interactions due to the combination of the indene moiety and the tetrazole ring, which could influence its binding affinity in biological systems. Additionally, the compound's stability, solubility, and reactivity can be affected by the substituents on the indene structure. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, owing to its structural features that can be tailored for specific biological targets. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C12H14N4O
InChI:InChI=1/C12H14N4O/c1-17-10-5-4-8-2-3-9(11(8)7-10)6-12-13-15-16-14-12/h4-5,7,9H,2-3,6H2,1H3,(H,13,14,15,16)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.