CAS 87929-14-4

5-[(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole

Description:

5-[(5,6-Dimethoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole is a chemical compound characterized by its unique structure, which includes a tetrazole ring and an indene derivative. The presence of the tetrazole moiety contributes to its potential biological activity, as tetrazoles are known for their diverse pharmacological properties. The compound features two methoxy groups attached to the indene structure, which can influence its solubility and reactivity. This compound may exhibit interesting interactions due to the presence of both nitrogen-rich tetrazole and the hydrophobic indene framework. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals. The compound's CAS number, 87929-14-4, allows for easy identification in chemical databases and literature. Overall, the characteristics of this compound make it a subject of interest for further research, particularly in the fields of organic synthesis and drug discovery.

Formula: C₁₃H₁₆N₄O₂

InChI: InChI=1/C13H16N4O2/c1-18-11-5-8-3-4-9(6-13-14-16-17-15-13)10(8)7-12(11)19-2/h5,7,9H,3-4,6H2,1-2H3,(H,14,15,16,17)

InChI key: OWPUDTSJGXIHKB-UHFFFAOYSA-N

SMILES: COC1=C(C=C2C(CCC2=C1)CC3=NNN=N3)OC