CAS 87932-38-5

Ethanamine, 2-[[2-(trimethylsilyl)ethyl]thio]-, (2Z)-2-butenedioate (2:1)

Description:

Ethanamine, 2-[[2-(trimethylsilyl)ethyl]thio]-, (2Z)-2-butenedioate (2:1), identified by CAS number 87932-38-5, is a chemical compound characterized by its unique structure that includes an ethanamine backbone, a thioether functional group, and a butenedioate moiety. The presence of the trimethylsilyl group enhances its stability and solubility in organic solvents, making it useful in various chemical applications. This compound exhibits properties typical of amines, such as basicity and nucleophilicity, which can facilitate reactions with electrophiles. The thioether linkage contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of sulfur-containing compounds. Additionally, the (2Z)-2-butenedioate component suggests potential for participation in conjugate addition reactions or as a precursor in the synthesis of more complex molecules. Overall, this compound's unique functional groups and structural features make it a valuable intermediate in organic chemistry and materials science.

Formula: C₇H₁₉NSSiC₄H₄O₄

InChI: InChI=1S/C7H19NSSi.C4H4O4/c1-10(2,3)7-6-9-5-4-8;5-3(6)1-2-4(7)8/h4-8H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-

InChI key: InChIKey=KZZNGPAELKNPIC-BTJKTKAUSA-N

SMILES: C(C[Si](C)(C)C)SCCN.C(=C\C(O)=O)\C(O)=O

Synonyms:

• Ethanamine, 2-[[2-(trimethylsilyl)ethyl]thio]-, (2Z)-2-butenedioate (2:1)
• Ethanamine, 2-[[2-(trimethylsilyl)ethyl]thio]-, (Z)-2-butenedioate (2:1)