CAS 87932-50-1
:2-Chloro-3,4-dihydroxybenzoic acid
Description:
2-Chloro-3,4-dihydroxybenzoic acid, with the CAS number 87932-50-1, is an aromatic compound characterized by the presence of a chloro group and two hydroxyl groups on a benzoic acid framework. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents due to its hydroxyl groups, which can engage in hydrogen bonding. The presence of the chloro substituent can influence its reactivity and biological activity, making it of interest in various chemical and pharmaceutical applications. The hydroxyl groups contribute to its acidity, allowing it to act as a weak acid in solution. Additionally, the compound may exhibit antioxidant properties, which can be beneficial in biological systems. Its structural features suggest potential uses in organic synthesis, as well as in the development of agrochemicals or pharmaceuticals. As with many chlorinated compounds, care should be taken regarding its environmental impact and toxicity, necessitating proper handling and disposal practices.
Formula:C7H5ClO4
InChI:InChI=1S/C7H5ClO4/c8-5-3(7(11)12)1-2-4(9)6(5)10/h1-2,9-10H,(H,11,12)
InChI key:InChIKey=IEKVQMDBVWMVMB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C(O)=C(O)C=C1
Synonyms:- Protocatechuic acid, 2-chloro-
- 2-Chloroprotocatechuic acid
- 2-Chloro-3,4-dihydroxybenzoic acid
- Benzoic acid, 2-chloro-3,4-dihydroxy-
- CHLORO-3,4-DIHYDROXYBENZOIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-3,4-dihydroxybenzoic acid
CAS:Formula:C7H5ClO4Purity:95%Color and Shape:SolidMolecular weight:188.56522-Chloro-3,4-dihydroxybenzoic acid
CAS:2-Chloro-3,4-dihydroxybenzoic acidPurity:97%Molecular weight:188.57g/mol2-Chloro-3,4-dihydroxybenzoic acid
CAS:Formula:C7H5ClO4Purity:95%Color and Shape:SolidMolecular weight:188.562-Chloro-3,4-dihydroxybenzoic acid
CAS:Controlled ProductApplications 2-Chloro-3,4-dihydroxybenzoic acid (cas# 87932-50-1) is a useful research chemical.
Formula:C7H5ClO4Color and Shape:NeatMolecular weight:188.562-Chloro-3,4-dihydroxybenzoic acid
CAS:Cefepime is a broad-spectrum antibiotic that is used to treat bacterial infections. It inhibits cell wall synthesis by binding to the penicillin-binding proteins and interfering with the cross-linking of peptidoglycan. Cefepime has been shown to be active against gram-negative pathogens such as Aeruginosa, Stenotrophomonas maltophilia, and P. aeruginosa. Cefepime also inhibits the growth of gram-positive bacteria such as Staphylococcus aureus, Enterococcus faecalis, and Streptococcus pneumoniae. The chemical structure of cefepime is similar to that of other beta-lactam antibiotics like methicillin, oxacillin, cloxacillin, ampicillin, and amoxicillin. Cefepime has been shown to be effective in treating resistant gram-negative organisms such as Pseudomonas aeruginosa (P.Formula:C7H5ClO4Purity:Min. 95%Color and Shape:White To Yellow To Light Brown SolidMolecular weight:188.56 g/mol




