CAS 879326-77-9

5-[(2,2-Dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid

Description:

5-[(2,2-Dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid, identified by its CAS number 879326-77-9, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and an amino group linked to a dimethyl-oxopropyl moiety. This structure suggests that it possesses both acidic and basic functional groups, which may contribute to its potential as a zwitterion under certain conditions. The presence of the pyridine ring indicates that the compound may exhibit aromatic characteristics, influencing its reactivity and interaction with other molecules. The dimethyl-1-oxopropyl substituent may enhance lipophilicity, potentially affecting its solubility and bioavailability in biological systems. Additionally, the compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and spectral data, would require empirical measurement or literature reference for detailed analysis. Overall, this compound's unique structure positions it as a candidate for further research in chemical and pharmaceutical applications.

Formula: C₁₁H₁₄N₂O₃

InChI: InChI=1S/C11H14N2O3/c1-11(2,3)10(16)13-8-4-7(9(14)15)5-12-6-8/h4-6H,1-3H3,(H,13,16)(H,14,15)

InChI key: InChIKey=VHYYHNBAUXHABM-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)C)=O)C=1C=C(C(O)=O)C=NC1

Synonyms:

• 3-Pyridinecarboxylic acid, 5-[(2,2-dimethyl-1-oxopropyl)amino]-
• 5-[(2,2-Dimethyl-1-oxopropyl)amino]-3-pyridinecarboxylic acid

3-(Pivaloylamino)nicotinic acid

CAS: 879326-77-9

Formula: C₁₁H₁₄N₂O₃

Purity: 95%

Molecular weight: 222.2405

Ref: IN-DA004DNL

5-Pivalamidonicotinic Acid

CAS: 879326-77-9

5-Pivalamidonicotinic Acid

Purity: 99%

Molecular weight: 222.24g/mol

Ref: 54-OR1011930