CymitQuimica logo

CAS 879326-78-0

:

N-(5-Chloro-3-pyridinyl)-2,2-dimethylpropanamide

Description:
N-(5-Chloro-3-pyridinyl)-2,2-dimethylpropanamide is a chemical compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a pyridine ring substituted with a chlorine atom at the 5-position, contributing to its unique reactivity and potential biological activity. The presence of the 2,2-dimethylpropanamide moiety indicates that it has a branched aliphatic structure, which can influence its solubility and steric properties. Typically, compounds like this may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The chlorine substituent can enhance lipophilicity and may also play a role in the compound's interaction with biological targets. Additionally, the molecular structure suggests potential applications in drug development or as a chemical intermediate. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which they are measured.
Formula:C10H13ClN2O
InChI:InChI=1S/C10H13ClN2O/c1-10(2,3)9(14)13-8-4-7(11)5-12-6-8/h4-6H,1-3H3,(H,13,14)
InChI key:InChIKey=TXYASGLTJVGMHT-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C=C(Cl)C=NC1
Synonyms:
  • N-(5-Chloro-3-pyridinyl)-2,2-dimethylpropanamide
  • N-(5-Chloropyridin-3-yl)-2,2-dimethylpropanamide
  • N-(5-chloropyridin-3-yl)pivalamide
  • propanamide, N-(5-chloro-3-pyridinyl)-2,2-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.