CAS 879326-79-1
:Pyridine, 3-(chloromethyl)-5-iodo-, hydrochloride (1:1)
Description:
Pyridine, 3-(chloromethyl)-5-iodo-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloromethyl group at the 3-position and an iodine atom at the 5-position contributes to its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other functional groups. Safety precautions should be taken when handling this compound, as halogenated pyridines can be toxic and may pose environmental hazards. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C6H5ClIN·ClH
InChI:InChI=1S/C6H5ClIN.ClH/c7-2-5-1-6(8)4-9-3-5;/h1,3-4H,2H2;1H
InChI key:InChIKey=BKXIXOQERHWQPJ-UHFFFAOYSA-N
SMILES:C(Cl)C=1C=C(I)C=NC1.Cl
Synonyms:- Pyridine, 3-(chloromethyl)-5-iodo-, hydrochloride
- Pyridine, 3-(chloromethyl)-5-iodo-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
