CymitQuimica logo

CAS 879326-80-4

:

3-(Dimethoxymethyl)-5-[2-(trimethylsilyl)ethynyl]pyridine

Description:
3-(Dimethoxymethyl)-5-[2-(trimethylsilyl)ethynyl]pyridine, with CAS number 879326-80-4, is a pyridine derivative characterized by its unique functional groups that contribute to its chemical properties. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the dimethoxymethyl group enhances its solubility and reactivity, while the trimethylsilyl ethynyl group introduces a degree of hydrophobicity and can facilitate various chemical reactions, such as cross-coupling or nucleophilic substitutions. The trimethylsilyl group is known for its ability to protect functional groups during synthetic processes. Overall, this compound may exhibit interesting biological activities and can be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its structural characteristics suggest potential applications in medicinal chemistry, where modifications to the pyridine core can lead to compounds with enhanced efficacy or selectivity.
Formula:C13H19NO2Si
InChI:InChI=1S/C13H19NO2Si/c1-15-13(16-2)12-8-11(9-14-10-12)6-7-17(3,4)5/h8-10,13H,1-5H3
InChI key:InChIKey=OZASIYDGVNBWMZ-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C=C(C#C[Si](C)(C)C)C=NC1
Synonyms:
  • Pyridine, 3-(dimethoxymethyl)-5-[(trimethylsilyl)ethynyl]-
  • 3-(Dimethoxymethyl)-5-[2-(trimethylsilyl)ethynyl]pyridine
  • Pyridine, 3-(dimethoxymethyl)-5-[2-(trimethylsilyl)ethynyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.