CAS 879326-81-5
:3-Chloro-5-(dimethoxymethyl)pyridine
Description:
3-Chloro-5-(dimethoxymethyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the 3-position and a dimethoxymethyl group at the 5-position contributes to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications, particularly in organic synthesis and medicinal chemistry. The dimethoxymethyl group enhances its potential as a building block in the synthesis of more complex molecules. Additionally, the chlorine substituent can participate in nucleophilic substitution reactions, making this compound valuable in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Chloro-5-(dimethoxymethyl)pyridine is a versatile intermediate in chemical synthesis.
Formula:C8H10ClNO2
InChI:InChI=1S/C8H10ClNO2/c1-11-8(12-2)6-3-7(9)5-10-4-6/h3-5,8H,1-2H3
InChI key:InChIKey=PHIZFDWNWYNBNG-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C=C(Cl)C=NC1
Synonyms:- 3-Chloro-5-(dimethoxymethyl)pyridine
- Pyridine, 3-chloro-5-(dimethoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
