CymitQuimica logo

CAS 879329-76-7

:

1H-Pyrrole-1-propanoic acid,3-(ethoxycarbonyl)-5-(4-fluorophenyl)-2-methyl-

Description:
1H-Pyrrole-1-propanoic acid, 3-(ethoxycarbonyl)-5-(4-fluorophenyl)-2-methyl- is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing one nitrogen atom. This compound features a propanoic acid functional group, indicating it has acidic properties, and an ethoxycarbonyl group, which suggests it can participate in various chemical reactions, including esterification. The presence of a 4-fluorophenyl substituent introduces a fluorine atom, which can influence the compound's reactivity and biological activity due to the electronegative nature of fluorine. Additionally, the methyl group at the 2-position of the pyrrole ring can affect steric and electronic properties. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the molecular interactions dictated by its functional groups and overall structure.
Formula:C17H18FNO4
InChI:InChI=1S/C17H18FNO4/c1-3-23-17(22)14-10-15(12-4-6-13(18)7-5-12)19(11(14)2)9-8-16(20)21/h4-7,10H,3,8-9H2,1-2H3,(H,20,21)
InChI key:InChIKey=QVZRTFYPSGMJNG-UHFFFAOYSA-N
SMILES:C(CC(O)=O)N1C(=CC(C(OCC)=O)=C1C)C2=CC=C(F)C=C2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.