CAS 879329-84-7

5-(4-Methoxyphenyl)-1-(3-methoxypropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylic acid

Description:

5-(4-Methoxyphenyl)-1-(3-methoxypropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylic acid is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring substituted with various functional groups. The presence of methoxy groups contributes to its potential solubility in organic solvents and may influence its reactivity and biological activity. The carboxylic acid functional group suggests that the compound can participate in acid-base reactions and may exhibit polar characteristics, enhancing its interactions with biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could confer specific pharmacological properties. Additionally, the presence of multiple methyl groups can affect the compound's steric properties and overall stability. Its CAS number, 879329-84-7, allows for easy identification in chemical databases, facilitating research and development in various applications, including drug discovery and material science. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various scientific fields.

Formula: C₁₈H₂₃NO₄

InChI: InChI=1S/C18H23NO4/c1-12-16(18(20)21)13(2)19(10-5-11-22-3)17(12)14-6-8-15(23-4)9-7-14/h6-9H,5,10-11H2,1-4H3,(H,20,21)

InChI key: InChIKey=VTAYNXCWVIIWLT-UHFFFAOYSA-N

SMILES: C(CCOC)N1C(=C(C)C(C(O)=O)=C1C)C2=CC=C(OC)C=C2

Synonyms:

• 1H-Pyrrole-3-carboxylic acid, 5-(4-methoxyphenyl)-1-(3-methoxypropyl)-2,4-dimethyl-
• 5-(4-Methoxyphenyl)-1-(3-methoxypropyl)-2,4-dimethyl-1H-pyrrole-3-carboxylic acid