CAS 87935-31-7

Pentanedioic acid, 2-(3-oxo-8-azabicyclo[3.2.1]oct-8-yl)-, diethyl ester

Description:

Pentanedioic acid, 2-(3-oxo-8-azabicyclo[3.2.1]oct-8-yl)-, diethyl ester, commonly referred to by its CAS number 87935-31-7, is an organic compound characterized by its structure, which includes a pentanedioic acid backbone and a bicyclic azabicyclo structure. This compound features two ethyl ester groups, which enhance its solubility and reactivity. The bicyclic system contributes to its unique chemical properties, potentially influencing its reactivity and interaction with biological systems. The presence of the keto group (3-oxo) suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. This compound may be of interest in synthetic organic chemistry and medicinal chemistry due to its potential applications in drug development or as an intermediate in the synthesis of more complex molecules. Its specific physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups.

Formula: C₁₆H₂₅NO₅

InChI: InChI=1S/C16H25NO5/c1-3-21-15(19)8-7-14(16(20)22-4-2)17-11-5-6-12(17)10-13(18)9-11/h11-12,14H,3-10H2,1-2H3

InChI key: ZPTYCNZRXMVFRW-UHFFFAOYSA-N

SMILES: CCOC(=O)CCC(C(=O)OCC)N1C2CCC1CC(=O)C2