CAS 87936-24-1
:palladium(2+) chloride - 6-methylpyridin-2-amine (1:2:1)
Description:
Palladium(2+) chloride - 6-methylpyridin-2-amine (1:2:1) is a coordination compound featuring palladium in a +2 oxidation state, coordinated with chloride ions and 6-methylpyridin-2-amine ligands. The palladium center typically exhibits a square planar geometry, which is characteristic of many palladium(II) complexes. The presence of 6-methylpyridin-2-amine, an aromatic amine, contributes to the compound's stability and solubility in various solvents. This compound may exhibit interesting catalytic properties, particularly in organic synthesis, due to the ability of palladium to facilitate various reactions, such as cross-coupling reactions. Additionally, the presence of the pyridine ring can influence the electronic properties of the complex, potentially enhancing its reactivity. The compound's CAS number, 87936-24-1, allows for easy identification in chemical databases. Overall, this compound is of interest in coordination chemistry and catalysis, with potential applications in pharmaceuticals and materials science.
Formula:C6H8Cl2N2Pd
InChI:InChI=1/C6H8N2.2ClH.Pd/c1-5-3-2-4-6(7)8-5;;;/h2-4H,1H3,(H2,7,8);2*1H;/q;;;+2/p-2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Palladium,dichlorobis(6-methyl-2-pyridinamine-N1)-, (SP-4-2)- (9CI)
CAS:Formula:C6H8Cl2N2PdMolecular weight:285.4671
