CymitQuimica logo

CAS 87937-61-9

:

3-chloro-5,6,7,8-tetrahydro-2H-chromen-2-one

Description:
3-Chloro-5,6,7,8-tetrahydro-2H-chromen-2-one is a chemical compound belonging to the class of chromones, which are characterized by a benzopyranone structure. This specific compound features a chloro substituent at the 3-position and a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated ring structure. The presence of the chloro group can influence its reactivity and solubility, making it potentially useful in various chemical reactions and applications. The compound is typically a solid at room temperature and may exhibit moderate to low solubility in water, depending on the specific conditions. Its molecular structure suggests potential biological activity, which is common among chromone derivatives, often leading to applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, 3-chloro-5,6,7,8-tetrahydro-2H-chromen-2-one is a versatile compound with interesting chemical properties.
Formula:C9H9ClO2
InChI:InChI=1/C9H9ClO2/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h5H,1-4H2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.