CAS 879374-49-9

1-(1,1-Dimethylethyl) 2-methyl (2R,4S)-4-methyl-1,2-pyrrolidinedicarboxylate

Description:

1-(1,1-Dimethylethyl) 2-methyl (2R,4S)-4-methyl-1,2-pyrrolidinedicarboxylate, with the CAS number 879374-49-9, is a chemical compound characterized by its pyrrolidine structure, which features two carboxylate groups and several alkyl substituents. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits moderate solubility in organic solvents, while its solubility in water is limited due to its hydrophobic alkyl groups. The presence of multiple chiral centers in its structure contributes to its stereochemical complexity, which can influence its biological activity and reactivity. As a derivative of pyrrolidine, it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Its potential applications could span across pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific uses would depend on further research into its properties and biological interactions. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₂₁NO₄

InChI: InChI=1S/C12H21NO4/c1-8-6-9(10(14)16-5)13(7-8)11(15)17-12(2,3)4/h8-9H,6-7H2,1-5H3/t8-,9+/m0/s1

InChI key: InChIKey=RTBTZFJPMXXHHP-DTWKUNHWSA-N

SMILES: C(OC(C)(C)C)(=O)N1[C@@H](C(OC)=O)C[C@H](C)C1

Synonyms:

• 1,2-Pyrrolidinedicarboxylic acid, 4-methyl-, 1-(1,1-dimethylethyl) 2-methyl ester, (2R,4S)-
• 1-(1,1-Dimethylethyl) 2-methyl (2R,4S)-4-methyl-1,2-pyrrolidinedicarboxylate