CAS 87939-27-3
:1,5-diphenyl-2-{3-[4-(pyridin-2-yl)piperazin-1-yl]propyl}-1,2-dihydro-3H-pyrazol-3-one hydrochloride (1:1)
Description:
1,5-Diphenyl-2-{3-[4-(pyridin-2-yl)piperazin-1-yl]propyl}-1,2-dihydro-3H-pyrazol-3-one hydrochloride is a complex organic compound characterized by its multi-functional structure, which includes a pyrazolone core, phenyl groups, and a piperazine moiety substituted with a pyridine ring. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the piperazine and pyridine groups suggests possible interactions with biological targets, potentially influencing its pharmacological profile. The hydrochloride salt form enhances its stability and solubility in aqueous environments, which is advantageous for drug formulation. Additionally, the compound may exhibit specific reactivity patterns due to the presence of functional groups, allowing for further derivatization or modification. Overall, its unique structural features contribute to its potential applications in therapeutic contexts, particularly in the development of novel pharmacological agents.
Formula:C27H30ClN5O
InChI:InChI=1/C27H29N5O.ClH/c33-27-22-25(23-10-3-1-4-11-23)32(24-12-5-2-6-13-24)31(27)17-9-16-29-18-20-30(21-19-29)26-14-7-8-15-28-26;/h1-8,10-15,22H,9,16-21H2;1H
Synonyms:- 3H-Pyrazol-3-one, 1,2-dihydro-1,5-diphenyl-2-(3-(4-(2-pyridinyl)-1-piperazinyl)propyl)-, monohydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Diphenyl-1-(3-(4-(2-pyridyl)-1-piperazinyl)propyl)-3-pyrazolin-5-one
CAS:Formula:C27H29N5OMolecular weight:439.5521
