CAS 879405-89-7

1-[[4-(1,1-Dimethylethyl)phenyl]sulfonyl]-2-piperidinecarboxylic acid

Description:

1-[[4-(1,1-Dimethylethyl)phenyl]sulfonyl]-2-piperidinecarboxylic acid is a chemical compound characterized by its sulfonamide functional group, which contributes to its potential biological activity. The presence of a piperidine ring indicates that it may exhibit properties typical of piperidine derivatives, such as being a potential pharmacophore in medicinal chemistry. The bulky tert-butyl group attached to the phenyl ring enhances lipophilicity, which can influence the compound's solubility and permeability in biological systems. This compound may also exhibit specific stereochemistry due to the presence of chiral centers, which can affect its interaction with biological targets. Its sulfonyl group can participate in various chemical reactions, making it a versatile building block in organic synthesis. Overall, this compound's unique structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₆H₂₃NO₄S

InChI: InChI=1S/C16H23NO4S/c1-16(2,3)12-7-9-13(10-8-12)22(20,21)17-11-5-4-6-14(17)15(18)19/h7-10,14H,4-6,11H2,1-3H3,(H,18,19)

InChI key: InChIKey=RCDVRHPRTUWQJA-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C(C(O)=O)CCCC1)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• 2-Piperidinecarboxylic acid, 1-[[4-(1,1-dimethylethyl)phenyl]sulfonyl]-
• 1-[[4-(1,1-Dimethylethyl)phenyl]sulfonyl]-2-piperidinecarboxylic acid
• 1-(4-tert-Butylbenzenesulfonyl)piperidine-2-carboxylic acid