CAS 879409-38-8

1,3-Disilacyclobutane, 1,3-bis(1-methylethoxy)-1,3-bis(4-methylphenyl)-

Description:

1,3-Disilacyclobutane, 1,3-bis(1-methylethoxy)-1,3-bis(4-methylphenyl)-, identified by CAS number 879409-38-8, is a silacyclobutane derivative characterized by the presence of silicon atoms in its cyclic structure. This compound features a four-membered ring with two silicon atoms and is substituted at both silicon centers with bulky groups, specifically 1-methylethoxy and 4-methylphenyl groups. The presence of these substituents contributes to its unique physical and chemical properties, such as enhanced thermal stability and potential applications in materials science, particularly in the development of polymers and coatings. The silacyclobutane framework may also impart interesting electronic properties due to the silicon atoms, which can influence reactivity and interaction with other chemical species. Overall, this compound exemplifies the integration of silicon into organic frameworks, showcasing the versatility of organosilicon chemistry.

Formula: C₂₂H₃₂O₂Si₂

InChI: InChI=1S/C22H32O2Si2/c1-17(2)23-25(21-11-7-19(5)8-12-21)15-26(16-25,24-18(3)4)22-13-9-20(6)10-14-22/h7-14,17-18H,15-16H2,1-6H3

InChI key: WURJESSKBGLBMG-UHFFFAOYSA-N

SMILES: CC1=CC=C(C=C1)[Si]2(C[Si](C2)(C3=CC=C(C=C3)C)OC(C)C)OC(C)C