CAS 87942-08-3

4-n-Propylphenylmagnesium Bromide

Description:

4-n-Propylphenylmagnesium bromide is an organomagnesium compound, specifically a Grignard reagent, characterized by its reactivity and utility in organic synthesis. It consists of a phenyl group substituted with a propyl chain at the para position, bonded to a magnesium atom, which is in turn associated with a bromide ion. This compound is typically a colorless to light yellow liquid or solid, depending on its form and purity. Grignard reagents like 4-n-Propylphenylmagnesium bromide are known for their strong nucleophilic properties, allowing them to react with a variety of electrophiles, including carbonyl compounds, to form alcohols. The presence of the propyl group influences the steric and electronic properties of the phenyl ring, potentially affecting the reactivity and selectivity in synthetic applications. Due to its reactivity with moisture and air, it must be handled under an inert atmosphere, typically in anhydrous conditions. Safety precautions are essential, as Grignard reagents can be hazardous and reactive with water and other protic solvents.

Formula: C₉H₁₁BrMg

InChI: InChI=1/C9H11.BrH.Mg/c1-2-6-9-7-4-3-5-8-9;;/h4-5,7-8H,2,6H2,1H3;1H;/q;;+1/p-1/rC9H11BrMg/c1-2-3-8-4-6-9(11-10)7-5-8/h4-7H,2-3H2,1H3

SMILES: CCCC1=CC=C=C[CH]1.Br.[Mg]

Synonyms:

• Bromo-(4-Propylphenyl)Magnesium