CAS 87943-77-9

8-Azaspiro[5.7]tridecane, 8-(1-pyrrolidinylcarbonyl)-

Description:

8-Azaspiro[5.7]tridecane, 8-(1-pyrrolidinylcarbonyl)-, identified by its CAS number 87943-77-9, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a nitrogen atom in the spiro framework and a pyrrolidinylcarbonyl substituent. This compound features a bicyclic system that contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the pyrrolidinyl group suggests possible interactions with biological targets, potentially influencing its pharmacological properties. The compound's molecular structure may impart specific steric and electronic characteristics, affecting its solubility, stability, and reactivity. Additionally, the azaspiro configuration can lead to interesting conformational dynamics, which may be relevant in drug design and development. Overall, 8-Azaspiro[5.7]tridecane, 8-(1-pyrrolidinylcarbonyl)- represents a class of compounds that could be explored for various applications, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₁₇H₃₀N₂O

InChI: InChI=1S/C17H30N2O/c20-16(18-12-7-8-13-18)19-14-6-2-5-11-17(15-19)9-3-1-4-10-17/h1-15H2

InChI key: ULMRIMIMDNBQED-UHFFFAOYSA-N

SMILES: C1CCC2(CC1)CCCCCN(C2)C(=O)N3CCCC3