CAS 87945-96-8

Naphthalene, 1-(bromomethyl)-1,2,3,4-tetrahydro-4-(1-methylethyl)-

Description:

Naphthalene, 1-(bromomethyl)-1,2,3,4-tetrahydro-4-(1-methylethyl)-, with the CAS number 87945-96-8, is an organic compound characterized by its complex structure, which includes a naphthalene ring system and a bromomethyl group. This compound features a tetrahydro structure, indicating the presence of a saturated cyclic system, and a branched alkyl group (1-methylethyl) that contributes to its hydrophobic nature. It is typically a colorless to pale yellow solid at room temperature, exhibiting a characteristic aromatic odor. The presence of the bromine atom suggests potential reactivity, particularly in nucleophilic substitution reactions. Naphthalene derivatives are often studied for their applications in organic synthesis, materials science, and as intermediates in the production of various chemicals. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, can vary based on its molecular interactions and the presence of functional groups. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₁₄H₁₉Br

InChI: InChI=1S/C14H19Br/c1-10(2)12-8-7-11(9-15)13-5-3-4-6-14(12)13/h3-6,10-12H,7-9H2,1-2H3

InChI key: TXQUBTDLOXJNIF-UHFFFAOYSA-N

SMILES: CC(C)C1CCC(C2=CC=CC=C12)CBr