CAS 87946-00-7

Benzene, (4,5-dibromo-1-ethylpentyl)-

Description:

Benzene, (4,5-dibromo-1-ethylpentyl)-, identified by its CAS number 87946-00-7, is an organic compound characterized by a benzene ring substituted with both bromine atoms and an ethylpentyl group. The presence of bromine atoms introduces significant reactivity, particularly in electrophilic substitution reactions, while the ethylpentyl group contributes to the compound's hydrophobic nature and influences its physical properties, such as boiling and melting points. This compound is likely to be a colorless to pale yellow liquid, exhibiting typical aromatic characteristics, including a distinct odor. Its solubility in organic solvents is expected to be high, while its solubility in water is minimal due to the hydrophobic alkyl chain. The dibromo substitution pattern may also impart unique biological activity or toxicity, necessitating careful handling and consideration in applications. As with many brominated compounds, it may be subject to environmental regulations due to potential persistence and bioaccumulation. Overall, the compound's structure suggests a balance between aromatic stability and the reactivity introduced by the bromine substituents.

Formula: C₁₃H₁₈Br₂

InChI: InChI=1S/C13H18Br2/c1-2-11(8-9-13(15)10-14)12-6-4-3-5-7-12/h3-7,11,13H,2,8-10H2,1H3

InChI key: SJHBHGWNMGYJEP-UHFFFAOYSA-N

SMILES: CCC(CCC(CBr)Br)C1=CC=CC=C1