CAS 87946-66-5

Benzoic acid, 4,4'-[1,2-ethanediylbis(oxy)]bis-, bis(4-cyanophenyl) ester

Description:

Benzoic acid, 4,4'-[1,2-ethanediylbis(oxy)]bis-, bis(4-cyanophenyl) ester, identified by CAS number 87946-66-5, is an organic compound characterized by its complex structure, which includes benzoic acid moieties and cyanophenyl groups. This compound typically exhibits properties associated with esters, such as being less polar than acids and potentially having lower boiling points. It is likely to be a solid at room temperature, with a crystalline or amorphous form depending on its purity and synthesis method. The presence of cyanophenyl groups suggests potential applications in materials science, particularly in the development of polymers or as intermediates in organic synthesis. Additionally, the ether linkages in its structure may impart certain thermal and chemical stability, making it suitable for various industrial applications. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound represents a unique combination of functional groups that may offer diverse applications in chemical research and industry.

Formula: C₃₀H₂₀N₂O₆

InChI: InChI=1S/C30H20N2O6/c31-19-21-1-9-27(10-2-21)37-29(33)23-5-13-25(14-6-23)35-17-18-36-26-15-7-24(8-16-26)30(34)38-28-11-3-22(20-32)4-12-28/h1-16H,17-18H2

InChI key: UDSAAADYGGKHSO-UHFFFAOYSA-N

SMILES: C1=CC(=CC=C1C#N)OC(=O)C2=CC=C(C=C2)OCCOC3=CC=C(C=C3)C(=O)OC4=CC=C(C=C4)C#N