CAS 87946-83-6

1,1'-Biphenyl, 3-chloro-4-(hexyloxy)-4'-pentyl-

Description:

1,1'-Biphenyl, 3-chloro-4-(hexyloxy)-4'-pentyl- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the 3-position and a hexyloxy group at the 4-position of one phenyl ring, along with a pentyl group at the 4'-position of the other ring, contributes to its unique chemical properties. This compound is likely to exhibit hydrophobic characteristics due to the long alkyl chains, which can influence its solubility in organic solvents and its behavior in various chemical environments. Additionally, the chlorine substituent may impart some degree of reactivity, potentially allowing for further chemical modifications. The presence of multiple functional groups suggests that it may have applications in materials science, particularly in the development of liquid crystals or as a component in organic electronics. Overall, the structural features of this compound indicate a complex interplay of hydrophobic and polar characteristics, making it an interesting subject for further study in organic chemistry.

Formula: C₂₃H₃₁ClO

InChI: InChI=1S/C23H31ClO/c1-3-5-7-9-17-25-23-16-15-21(18-22(23)24)20-13-11-19(12-14-20)10-8-6-4-2/h11-16,18H,3-10,17H2,1-2H3

InChI key: GJDDHOCWUAZPPF-UHFFFAOYSA-N

SMILES: CCCCCCOC1=C(C=C(C=C1)C2=CC=C(C=C2)CCCCC)Cl