CAS 87947-24-8

3-Thiabicyclo[3.3.1]nonane, 3,3-dioxide

Description:

3-Thiabicyclo[3.3.1]nonane, 3,3-dioxide, with the CAS number 87947-24-8, is a bicyclic compound characterized by a unique sulfur-containing structure. This compound features a bicyclic framework consisting of a nonane ring system with a sulfur atom incorporated into the structure, along with two oxide groups (dioxides) at the 3-position. The presence of the sulfur atom contributes to its distinct chemical properties, including potential reactivity and stability under various conditions. The dioxides suggest that the compound may exhibit interesting electronic properties and could participate in redox reactions. Typically, such compounds can be of interest in organic synthesis, medicinal chemistry, and materials science due to their unique structural features. Additionally, the bicyclic nature of the compound may influence its steric and electronic interactions, making it a subject of study for applications in drug design and development. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for detailed applications.

Formula: C₈H₁₄O₂S

InChI: InChI=1S/C8H14O2S/c9-11(10)5-7-2-1-3-8(4-7)6-11/h7-8H,1-6H2

InChI key: JDVVJUFZDNQVGL-UHFFFAOYSA-N

SMILES: C1CC2CC(C1)CS(=O)(=O)C2