CAS 87947-55-5

Thiophene-3-ol, 2,3-dihydro-4-(octylthio)-, 1,1-dioxide

Description:

Thiophene-3-ol, 2,3-dihydro-4-(octylthio)-, 1,1-dioxide, with CAS number 87947-55-5, is a sulfur-containing organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a hydroxyl group (-OH) at the 3-position and an octylthio group at the 4-position, contributing to its unique properties. The presence of the 1,1-dioxide functional group indicates that the compound has two double-bonded oxygen atoms attached to the sulfur atom, enhancing its reactivity and solubility in various solvents. Thiophene derivatives are known for their applications in organic electronics, pharmaceuticals, and as intermediates in chemical synthesis. The octylthio substituent imparts hydrophobic characteristics, potentially influencing the compound's solubility and interaction with biological systems. Overall, this compound's structure suggests it may exhibit interesting electronic and chemical properties, making it a subject of interest in materials science and organic chemistry research.

Formula: C₁₂H₂₂O₃S₂

InChI: InChI=1S/C12H22O3S2/c1-2-3-4-5-6-7-8-16-12-10-17(14,15)9-11(12)13/h10-11,13H,2-9H2,1H3

InChI key: QZJPTRLRCHVKBX-UHFFFAOYSA-N

SMILES: CCCCCCCCSC1=CS(=O)(=O)CC1O